DazireS718781 DazireS718781

30-10-2022
Mathematics

contestada

What is the probability that a randomly selected student will earn a 91 - 100 given they study for two to three hours?

What is the probability that a randomly selected student will earn a 91 100 given they study for two to three hours class=

Respuesta :

CharismaE344864 CharismaE344864

30-10-2022

Explanation

Let the probability that those who earn 91-100 be Pr(A) and the probability that those who studied for 2-3 hours be Pr(B)

[tex]Pr(A|B)=\frac{Pr(A\cap B)}{Pr(B)}=\frac{22}{45}[/tex]

Answer: 22/45 or 49.9%

Answer Link

Otras preguntas

Nutrition is the study of compounds called _________, their chemistry, and how they are used in the body. A nutrient is any element or compound necessary for or

A swimming pool has the shape of a box with a base that measures 25 m by 11 m and a uniform depth of 3.1 m. How much work is required to pump the water out of t

if cosxcos(pi/7)+sinxsin(pi/7)=root2/2

At the movie theater child admission is $5.40 and adult admission is $9.40 on Saturday 151 tickets were sold for a total sales of $1023.40 how many adult ticket

How did the French Revolution change the national identity of the French people? 1) The French identity became more centered on the culture of the local region

2.5-1 the individual fly, suppose that the probability of white eyes is 1/4 and the probability of red eyes is 3/4, and that we may treat these observations as

An investment adviser that is a sole proprietor finds that its net worth (net capital) has fallen below the minimum requirement. What asset can an owner of the

A coffee shop sells regular coffee in three sizes. The table shows the sizes of each regular coffee sold throughout the day. Write and solve a system of equatio

I REALLY NEED SOME HELP I NEED IT ASAP THERE ARE 2 QUESTIONSQUESTION 1How did the Reform Act of 1832 change the organization of political power in England?Selec

Can someone help me pls I’m not sure