Stitch17499 Stitch17499

28-04-2021
Mathematics

contestada

I need help! Extra points

I need help Extra points class=

Respuesta :

Аноним Аноним

28-04-2021

Question:

What is the surface area of the triangular prism?

Answer:

B) 120 square feet

Step-by-step explanation:

8 x 6 x 2.5 is equal to the surface area

120

Answer Link

Otras preguntas

How much work is required to assemble eight identical point charges, each of magnitude q, at the corners of a cube of side s? Note: Assume a reference level of

Write the expression as either the sine, cosine, or tangent of a single angle. sin(pi/2)cos(pi/7)+cos(pi/2)sin(pi/7)

Using complete sentences, describe how you would check the quotient of two rational expressions. Create and demonstrate your own example of this concept.

A boat makes a 120-mile trip downstream in 3 hours but makes the return trip in 4 hours.. . What is the rate of the current?. A) 3 mph. B) 4 mph. C) 5 mph.

NaOH + H2SO4 -> H2O + NaHSO4. The net ionic equation for this molecular equation was H+ + OH- = H2, meaning that H2SO4 needed to break up into H+ and HSO4-.

Read the final two lines of the first stanza of John McCrae’s “In Flanders Fields”:. The larks, still bravely singing, fly. Scarce heard amid the guns below.. .

During the action of a sodium-potassium pump, 50 ATP molecules were spent. Predict how many sodium ions are transported across the cell membrane.

Jason and Kyle both choose a number from 1 to 10 at random. What is the probability that both numbers are odd?. A.1/3. B.1/2. C.1/4 . D.1/8.

What is the difference between Baryons and Mesons?

How many hydrogen atoms are present in 2.00mg of aspartame