gabriellatorres1019
gabriellatorres1019 gabriellatorres1019
  • 27-03-2020
  • English
contestada

what do you mainly use your digital devices for?​

Respuesta :

hxneycxstard
hxneycxstard hxneycxstard
  • 27-03-2020
For work/school and socializing.
Answer Link
Dilly26
Dilly26 Dilly26
  • 27-03-2020
Mostly socializing and school
Answer Link

Otras preguntas

T/F urethrorrhea is bleeding from the urethra
The population of Indonesia can be modeled by the function P(t)=311(1+0.0138)t where P(t) measures the population in millions and t represents the number of yea
divide 8345 by 8 show your work​
1) a. What is the Lewis Structure for Nh3Cl+ b. What is the electron Domain geometry c. what is the molecular geometry. d. is it polar or non polar 2) Is Sncl3-
3. angle LMO = (9x + 18)° and angle PZJ = (2x + 19)°
Determine the electron geometry (eg) and molecular geometry (mg) of ICl₂⁻
Ram used to go temple simple past tense​
Rank the following carbocations in order of decreasing stability. Most Stable Least StableCC1[C]CCCC1[C+]C1CCCCC1 [tex]{ }^{+} \mathrm{CH}_3[/tex]C[C+]1CCCCC1
m = y2-y1 X2-X1 Find the slope of the line that passes through these two points. Simplify completely. (3,4) (5,5) m 8​
According to Cortes, how many people congregate in the market?